C34H58N4 — CID 126713435
4-N-(4-methylpentan-2-yl)-1-N-[10-[4-(4-methylpentan-2-ylamino)anilino]decyl]benzene-1,4-diamine (PubChem CID 126713435) has the molecular formula C34H58N4 and a molecular weight of 522.87 g/mol. Its IUPAC name is 4-N-(4-methylpentan-2-yl)-1-N-[10-[4-(4-methylpentan-2-ylamino)anilino]decyl]benzene-1,4-diamine.
| Compound Name | 4-N-(4-methylpentan-2-yl)-1-N-[10-[4-(4-methylpentan-2-ylamino)anilino]decyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 126713435 |
| Molecular Formula | C34H58N4 |
| Molecular Weight | 522.87 g/mol |
| Exact Mass | 522.47 |
| IUPAC Name | 4-N-(4-methylpentan-2-yl)-1-N-[10-[4-(4-methylpentan-2-ylamino)anilino]decyl]benzene-1,4-diamine |
| SMILES | CC(C)CC(C)Nc1ccc(NCCCCCCCCCCNc2ccc(NC(C)CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H58N4/c1-27(2)25-29(5)37-33-19-15-31(16-20-33)35-23-13-11-9-7-8-10-12-14-24-36-32-17-21-34(22-18-32)38-30(6)26-28(3)4/h15-22,27-30,35-38H,7-14,23-26H2,1-6H3 |
| InChIKey | HVYKEWRPXLMGEY-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.87 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|