C24H37N3 — CID 10981440
4-N-(4-methylpentan-2-yl)-1-N-[4-(4-methylpentan-2-ylamino)phenyl]benzene-1,4-diamine (PubChem CID 10981440) has the molecular formula C24H37N3 and a molecular weight of 367.58 g/mol. Its IUPAC name is 4-N-(4-methylpentan-2-yl)-1-N-[4-(4-methylpentan-2-ylamino)phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-(4-methylpentan-2-yl)-1-N-[4-(4-methylpentan-2-ylamino)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 10981440 |
| Molecular Formula | C24H37N3 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | 4-N-(4-methylpentan-2-yl)-1-N-[4-(4-methylpentan-2-ylamino)phenyl]benzene-1,4-diamine |
| SMILES | CC(C)CC(C)Nc1ccc(Nc2ccc(NC(C)CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H37N3/c1-17(2)15-19(5)25-21-7-11-23(12-8-21)27-24-13-9-22(10-14-24)26-20(6)16-18(3)4/h7-14,17-20,25-27H,15-16H2,1-6H3 |
| InChIKey | XVIYOTCRTMXQFK-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|