C36H60N2O2 — CID 158324844
4-N-(4-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine;octadecanoic acid (PubChem CID 158324844) has the molecular formula C36H60N2O2 and a molecular weight of 552.89 g/mol. Its IUPAC name is 4-N-(4-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine;octadecanoic acid.
| Compound Name | 4-N-(4-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine;octadecanoic acid |
|---|---|
| PubChem CID | 158324844 |
| Molecular Formula | C36H60N2O2 |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.47 |
| IUPAC Name | 4-N-(4-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine;octadecanoic acid |
| SMILES | CC(C)CC(C)Nc1ccc(Nc2ccccc2)cc1.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H24N2.C18H36O2/c1-14(2)13-15(3)19-17-9-11-18(12-10-17)20-16-7-5-4-6-8-16;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h4-12,14-15,19-20H,13H2,1-3H3;2-17H2,1H3,(H,19,20) |
| InChIKey | GPGYUCLLCSXTQN-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|