C17H24N4 — CID 23645208
N,N'-dipyridin-4-ylheptane-1,7-diamine (PubChem CID 23645208) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N,N'-dipyridin-4-ylheptane-1,7-diamine.
| Compound Name | N,N'-dipyridin-4-ylheptane-1,7-diamine |
|---|---|
| PubChem CID | 23645208 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N,N'-dipyridin-4-ylheptane-1,7-diamine |
| SMILES | c1cc(NCCCCCCCNc2ccncc2)ccn1 |
| InChI | InChI=1S/C17H24N4/c1(2-4-10-20-16-6-12-18-13-7-16)3-5-11-21-17-8-14-19-15-9-17/h6-9,12-15H,1-5,10-11H2,(H,18,20)(H,19,21) |
| InChIKey | DPHBVJUIPAIHRQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|