C10H17N3 — CID 62662678
N'-propan-2-yl-N-pyridin-4-ylethane-1,2-diamine (PubChem CID 62662678) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N'-propan-2-yl-N-pyridin-4-ylethane-1,2-diamine.
| Compound Name | N'-propan-2-yl-N-pyridin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62662678 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N'-propan-2-yl-N-pyridin-4-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNc1ccncc1 |
| InChI | InChI=1S/C10H17N3/c1-9(2)12-7-8-13-10-3-5-11-6-4-10/h3-6,9,12H,7-8H2,1-2H3,(H,11,13) |
| InChIKey | JUGWDHGJHIJHMV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|