C11H16ClFN2 — CID 54809625
N-(3-chloro-4-fluorophenyl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 54809625) has the molecular formula C11H16ClFN2 and a molecular weight of 230.71 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 54809625 |
| Molecular Formula | C11H16ClFN2 |
| Molecular Weight | 230.71 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H16ClFN2/c1-8(2)14-5-6-15-9-3-4-11(13)10(12)7-9/h3-4,7-8,14-15H,5-6H2,1-2H3 |
| InChIKey | MEUUEOZAQHJIPW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|