C11H16F2N2 — CID 115206228
N-(2,5-difluorophenyl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 115206228) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(2,5-difluorophenyl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 115206228 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-(2,5-difluorophenyl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNc1cc(F)ccc1F |
| InChI | InChI=1S/C11H16F2N2/c1-8(2)14-5-6-15-11-7-9(12)3-4-10(11)13/h3-4,7-8,14-15H,5-6H2,1-2H3 |
| InChIKey | WDKISGJUNKNOTN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|