C11H14N4 — CID 115669379
N-(3-pyrazol-1-ylpropyl)pyridin-4-amine (PubChem CID 115669379) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is N-(3-pyrazol-1-ylpropyl)pyridin-4-amine.
| Compound Name | N-(3-pyrazol-1-ylpropyl)pyridin-4-amine |
|---|---|
| PubChem CID | 115669379 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N-(3-pyrazol-1-ylpropyl)pyridin-4-amine |
| SMILES | c1cnn(CCCNc2ccncc2)c1 |
| InChI | InChI=1S/C11H14N4/c1(9-15-10-2-6-14-15)5-13-11-3-7-12-8-4-11/h2-4,6-8,10H,1,5,9H2,(H,12,13) |
| InChIKey | MYODLCCXBACVTM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|