C12H13F3N4 — CID 115579994
N-(3-pyrazol-1-ylpropyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 115579994) has the molecular formula C12H13F3N4 and a molecular weight of 270.26 g/mol. Its IUPAC name is N-(3-pyrazol-1-ylpropyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(3-pyrazol-1-ylpropyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115579994 |
| Molecular Formula | C12H13F3N4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-(3-pyrazol-1-ylpropyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cccnc1NCCCn1cccn1 |
| InChI | InChI=1S/C12H13F3N4/c13-12(14,15)10-4-1-5-16-11(10)17-6-2-8-19-9-3-7-18-19/h1,3-5,7,9H,2,6,8H2,(H,16,17) |
| InChIKey | AJAPCZJXQKHVGV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|