C12H16N4 — CID 23104821
4-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine (PubChem CID 23104821) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 4-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine.
| Compound Name | 4-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 23104821 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 4-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCCn2cccn2)cc1 |
| InChI | InChI=1S/C12H16N4/c13-11-3-5-12(6-4-11)14-7-1-9-16-10-2-8-15-16/h2-6,8,10,14H,1,7,9,13H2 |
| InChIKey | HKEHHGNKPUOMCF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|