C18H28N6 — CID 111904869
1-(3-anilinopropyl)-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111904869) has the molecular formula C18H28N6 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-(3-anilinopropyl)-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111904869 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 1-(3-anilinopropyl)-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCCNc1ccccc1 |
| InChI | InChI=1S/C18H28N6/c1-2-19-18(22-13-7-15-24-16-8-14-23-24)21-12-6-11-20-17-9-4-3-5-10-17/h3-5,8-10,14,16,20H,2,6-7,11-13,15H2,1H3,(H2,19,21,22) |
| InChIKey | FJFKKTTVWPIPAJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|