C21H32N6 — CID 111904469
1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111904469) has the molecular formula C21H32N6 and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111904469 |
| Molecular Formula | C21H32N6 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H32N6/c1-2-22-21(24-12-6-15-27-16-7-13-25-27)23-11-5-14-26-17-10-19-8-3-4-9-20(19)18-26/h3-4,7-9,13,16H,2,5-6,10-12,14-15,17-18H2,1H3,(H2,22,23,24) |
| InChIKey | XVJRJZDNRAMKKJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|