C15H28N6O2S — CID 111906311
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111906311) has the molecular formula C15H28N6O2S and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111906311 |
| Molecular Formula | C15H28N6O2S |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H28N6O2S/c1-2-16-15(17-5-3-8-21-9-4-6-19-21)18-7-10-20-11-13-24(22,23)14-12-20/h4,6,9H,2-3,5,7-8,10-14H2,1H3,(H2,16,17,18) |
| InChIKey | LMYHXRWXNNJUDD-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|