C15H32N4O2S — CID 111161343
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-hexylguanidine (PubChem CID 111161343) has the molecular formula C15H32N4O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-hexylguanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-hexylguanidine |
|---|---|
| PubChem CID | 111161343 |
| Molecular Formula | C15H32N4O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-hexylguanidine |
| SMILES | CCCCCC/N=C(\NCC)NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H32N4O2S/c1-3-5-6-7-8-17-15(16-4-2)18-9-10-19-11-13-22(20,21)14-12-19/h3-14H2,1-2H3,(H2,16,17,18) |
| InChIKey | BUIIWFODJCBEEF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|