C12H15IN4 — CID 113412372
4-iodo-1-N-(3-pyrazol-1-ylpropyl)benzene-1,2-diamine (PubChem CID 113412372) has the molecular formula C12H15IN4 and a molecular weight of 342.18 g/mol. Its IUPAC name is 4-iodo-1-N-(3-pyrazol-1-ylpropyl)benzene-1,2-diamine.
| Compound Name | 4-iodo-1-N-(3-pyrazol-1-ylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 113412372 |
| Molecular Formula | C12H15IN4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-iodo-1-N-(3-pyrazol-1-ylpropyl)benzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1NCCCn1cccn1 |
| InChI | InChI=1S/C12H15IN4/c13-10-3-4-12(11(14)9-10)15-5-1-7-17-8-2-6-16-17/h2-4,6,8-9,15H,1,5,7,14H2 |
| InChIKey | PPPDWVHEVROVOM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|