C12H14F3N5 — CID 106748029
4-N-(3-pyrazol-1-ylpropyl)-6-(trifluoromethyl)pyridine-3,4-diamine (PubChem CID 106748029) has the molecular formula C12H14F3N5 and a molecular weight of 285.27 g/mol. Its IUPAC name is 4-N-(3-pyrazol-1-ylpropyl)-6-(trifluoromethyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(3-pyrazol-1-ylpropyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 106748029 |
| Molecular Formula | C12H14F3N5 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-N-(3-pyrazol-1-ylpropyl)-6-(trifluoromethyl)pyridine-3,4-diamine |
| SMILES | Nc1cnc(C(F)(F)F)cc1NCCCn1cccn1 |
| InChI | InChI=1S/C12H14F3N5/c13-12(14,15)11-7-10(9(16)8-18-11)17-3-1-5-20-6-2-4-19-20/h2,4,6-8H,1,3,5,16H2,(H,17,18) |
| InChIKey | KUMSPUZAMVMIQX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|