C13H21N3 — CID 115689729
N-cyclopentyl-N'-pyridin-4-ylpropane-1,3-diamine (PubChem CID 115689729) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-cyclopentyl-N'-pyridin-4-ylpropane-1,3-diamine.
| Compound Name | N-cyclopentyl-N'-pyridin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115689729 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-cyclopentyl-N'-pyridin-4-ylpropane-1,3-diamine |
| SMILES | c1cc(NCCCNC2CCCC2)ccn1 |
| InChI | InChI=1S/C13H21N3/c1-2-5-12(4-1)15-8-3-9-16-13-6-10-14-11-7-13/h6-7,10-12,15H,1-5,8-9H2,(H,14,16) |
| InChIKey | XOEXZLRBYYQLFH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|