C12H19N3S — CID 115727070
N'-pyridin-4-yl-N-(thiolan-3-yl)propane-1,3-diamine (PubChem CID 115727070) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is N'-pyridin-4-yl-N-(thiolan-3-yl)propane-1,3-diamine.
| Compound Name | N'-pyridin-4-yl-N-(thiolan-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115727070 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N'-pyridin-4-yl-N-(thiolan-3-yl)propane-1,3-diamine |
| SMILES | c1cc(NCCCNC2CCSC2)ccn1 |
| InChI | InChI=1S/C12H19N3S/c1(6-15-12-4-9-16-10-12)5-14-11-2-7-13-8-3-11/h2-3,7-8,12,15H,1,4-6,9-10H2,(H,13,14) |
| InChIKey | KQFJFMBJJICOIG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|