C16H21N3S2 — CID 86787560
N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]thian-3-amine (PubChem CID 86787560) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]thian-3-amine.
| Compound Name | N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]thian-3-amine |
|---|---|
| PubChem CID | 86787560 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]thian-3-amine |
| SMILES | c1cc(-c2csc(CCCNC3CCCSC3)n2)ccn1 |
| InChI | InChI=1S/C16H21N3S2/c1(7-18-14-3-2-10-20-11-14)4-16-19-15(12-21-16)13-5-8-17-9-6-13/h5-6,8-9,12,14,18H,1-4,7,10-11H2 |
| InChIKey | WJEMIVREUYXVTL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|