C17H21FN2S — CID 82103393
N-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]cyclohexanamine (PubChem CID 82103393) has the molecular formula C17H21FN2S and a molecular weight of 304.43 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]cyclohexanamine.
| Compound Name | N-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]cyclohexanamine |
|---|---|
| PubChem CID | 82103393 |
| Molecular Formula | C17H21FN2S |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]cyclohexanamine |
| SMILES | Fc1ccc(-c2csc(CCNC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C17H21FN2S/c18-14-8-6-13(7-9-14)16-12-21-17(20-16)10-11-19-15-4-2-1-3-5-15/h6-9,12,15,19H,1-5,10-11H2 |
| InChIKey | LYQROFZFBFJNJH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |