C11H12N2S2 — CID 116968932
3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propane-1-thiol (PubChem CID 116968932) has the molecular formula C11H12N2S2 and a molecular weight of 236.37 g/mol. Its IUPAC name is 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propane-1-thiol.
| Compound Name | 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 116968932 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propane-1-thiol |
| SMILES | SCCCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C11H12N2S2/c14-7-1-2-11-13-10(8-15-11)9-3-5-12-6-4-9/h3-6,8,14H,1-2,7H2 |
| InChIKey | CBNLLCUBPHCLFP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|