C15H22N4S — CID 82103460
N',N'-dimethyl-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]propane-1,3-diamine (PubChem CID 82103460) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 82103460 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N',N'-dimethyl-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]propane-1,3-diamine |
| SMILES | CN(C)CCCNCCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C15H22N4S/c1-19(2)11-3-7-16-10-6-15-18-14(12-20-15)13-4-8-17-9-5-13/h4-5,8-9,12,16H,3,6-7,10-11H2,1-2H3 |
| InChIKey | YKMARBSFWLBUHV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|