C16H17NO4S — CID 90075907
4-[4-(benzenesulfonyl)anilino]butanoic acid (PubChem CID 90075907) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)anilino]butanoic acid.
| Compound Name | 4-[4-(benzenesulfonyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 90075907 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 4-[4-(benzenesulfonyl)anilino]butanoic acid |
| SMILES | O=C(O)CCCNc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO4S/c18-16(19)7-4-12-17-13-8-10-15(11-9-13)22(20,21)14-5-2-1-3-6-14/h1-3,5-6,8-11,17H,4,7,12H2,(H,18,19) |
| InChIKey | QZHWSQOMTJOSKT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|