C20H30N4O3 — CID 91328171
4-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]phenyl]imino-5-imino-2-methylcyclohex-2-en-1-ol (PubChem CID 91328171) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]phenyl]imino-5-imino-2-methylcyclohex-2-en-1-ol.
| Compound Name | 4-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]phenyl]imino-5-imino-2-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 91328171 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 4-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]phenyl]imino-5-imino-2-methylcyclohex-2-en-1-ol |
| SMILES | [H]/N=C1\CC(O)C(C)=C\C1=N/c1ccc(NCCCN(CCO)CCO)cc1 |
| InChI | InChI=1S/C20H30N4O3/c1-15-13-19(18(21)14-20(15)27)23-17-5-3-16(4-6-17)22-7-2-8-24(9-11-25)10-12-26/h3-6,13,20-22,25-27H,2,7-12,14H2,1H3/b21-18+,23-19+ |
| InChIKey | YUPSNQNNIHIFEB-DFFNRHJVSA-N |
| XLogP | 1.58 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|