C19H34ClN6+ — CID 145155306
chloromethane;N-[4-[(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)diazenyl]phenyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 145155306) has the molecular formula C19H34ClN6+ and a molecular weight of 381.98 g/mol. Its IUPAC name is chloromethane;N-[4-[(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)diazenyl]phenyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | chloromethane;N-[4-[(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)diazenyl]phenyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 145155306 |
| Molecular Formula | C19H34ClN6+ |
| Molecular Weight | 381.98 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | chloromethane;N-[4-[(1,3-dimethyl-1,2-dihydroimidazol-1-ium-2-yl)diazenyl]phenyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ccc(/N=N/C2N(C)C=C[NH+]2C)cc1.CCl |
| InChI | InChI=1S/C18H30N6.CH3Cl/c1-5-24(6-2)13-7-12-19-16-8-10-17(11-9-16)20-21-18-22(3)14-15-23(18)4;1-2/h8-11,14-15,18-19H,5-7,12-13H2,1-4H3;1H3/p+1/b21-20+; |
| InChIKey | JMBSCWHVXQEQBM-ANVLNOONSA-O |
| XLogP | 2.98 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.98 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|