C17H31N3 — CID 83961023
N'-[4-(diethylaminomethyl)phenyl]hexane-1,6-diamine (PubChem CID 83961023) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is N'-[4-(diethylaminomethyl)phenyl]hexane-1,6-diamine.
| Compound Name | N'-[4-(diethylaminomethyl)phenyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 83961023 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N'-[4-(diethylaminomethyl)phenyl]hexane-1,6-diamine |
| SMILES | CCN(CC)Cc1ccc(NCCCCCCN)cc1 |
| InChI | InChI=1S/C17H31N3/c1-3-20(4-2)15-16-9-11-17(12-10-16)19-14-8-6-5-7-13-18/h9-12,19H,3-8,13-15,18H2,1-2H3 |
| InChIKey | KYZBTKABKHCTHB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|