C19H27ClN4O3 — CID 90816004
4-[4-[2-[bis(2-hydroxyethyl)amino]ethylamino]phenyl]imino-6-chloro-5-imino-2-methylcyclohex-2-en-1-ol (PubChem CID 90816004) has the molecular formula C19H27ClN4O3 and a molecular weight of 394.90 g/mol. Its IUPAC name is 4-[4-[2-[bis(2-hydroxyethyl)amino]ethylamino]phenyl]imino-6-chloro-5-imino-2-methylcyclohex-2-en-1-ol.
| Compound Name | 4-[4-[2-[bis(2-hydroxyethyl)amino]ethylamino]phenyl]imino-6-chloro-5-imino-2-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 90816004 |
| Molecular Formula | C19H27ClN4O3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4-[4-[2-[bis(2-hydroxyethyl)amino]ethylamino]phenyl]imino-6-chloro-5-imino-2-methylcyclohex-2-en-1-ol |
| SMILES | [H]/N=C1C(=N/c2ccc(NCCN(CCO)CCO)cc2)/C=C(C)C(O)C/1Cl |
| InChI | InChI=1S/C19H27ClN4O3/c1-13-12-16(18(21)17(20)19(13)27)23-15-4-2-14(3-5-15)22-6-7-24(8-10-25)9-11-26/h2-5,12,17,19,21-22,25-27H,6-11H2,1H3/b21-18-,23-16+ |
| InChIKey | PLFHSQMKWUDJLT-KOLJFCIPSA-N |
| XLogP | 1.41 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|