C18H27N5O2 — CID 123980167
2-[2-(4-aminoanilino)ethyl-(2-hydroxyethyl)amino]-1-(2,5-diaminophenyl)ethanol (PubChem CID 123980167) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-[2-(4-aminoanilino)ethyl-(2-hydroxyethyl)amino]-1-(2,5-diaminophenyl)ethanol.
| Compound Name | 2-[2-(4-aminoanilino)ethyl-(2-hydroxyethyl)amino]-1-(2,5-diaminophenyl)ethanol |
|---|---|
| PubChem CID | 123980167 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-[2-(4-aminoanilino)ethyl-(2-hydroxyethyl)amino]-1-(2,5-diaminophenyl)ethanol |
| SMILES | Nc1ccc(NCCN(CCO)CC(O)c2cc(N)ccc2N)cc1 |
| InChI | InChI=1S/C18H27N5O2/c19-13-1-4-15(5-2-13)22-7-8-23(9-10-24)12-18(25)16-11-14(20)3-6-17(16)21/h1-6,11,18,22,24-25H,7-10,12,19-21H2 |
| InChIKey | NNKBWGLKMWYQOL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|