C23H30N6O — CID 91091911
2-[4-[1,3-bis(2,4-diaminophenyl)propylamino]anilino]ethanol (PubChem CID 91091911) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[4-[1,3-bis(2,4-diaminophenyl)propylamino]anilino]ethanol.
| Compound Name | 2-[4-[1,3-bis(2,4-diaminophenyl)propylamino]anilino]ethanol |
|---|---|
| PubChem CID | 91091911 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 2-[4-[1,3-bis(2,4-diaminophenyl)propylamino]anilino]ethanol |
| SMILES | Nc1ccc(CCC(Nc2ccc(NCCO)cc2)c2ccc(N)cc2N)c(N)c1 |
| InChI | InChI=1S/C23H30N6O/c24-16-3-1-15(21(26)13-16)2-10-23(20-9-4-17(25)14-22(20)27)29-19-7-5-18(6-8-19)28-11-12-30/h1,3-9,13-14,23,28-30H,2,10-12,24-27H2 |
| InChIKey | UQJKAJAMLPFCHD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 148.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|