C16H22N4O — CID 19389319
3,4-bis(4-aminoanilino)butan-1-ol (PubChem CID 19389319) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 3,4-bis(4-aminoanilino)butan-1-ol.
| Compound Name | 3,4-bis(4-aminoanilino)butan-1-ol |
|---|---|
| PubChem CID | 19389319 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 3,4-bis(4-aminoanilino)butan-1-ol |
| SMILES | Nc1ccc(NCC(CCO)Nc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C16H22N4O/c17-12-1-5-14(6-2-12)19-11-16(9-10-21)20-15-7-3-13(18)4-8-15/h1-8,16,19-21H,9-11,17-18H2 |
| InChIKey | ZNSAKPFFVKABTN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|