C17H24N4O2 — CID 67362410
3,5-bis(4-aminoanilino)pentane-1,4-diol (PubChem CID 67362410) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 3,5-bis(4-aminoanilino)pentane-1,4-diol.
| Compound Name | 3,5-bis(4-aminoanilino)pentane-1,4-diol |
|---|---|
| PubChem CID | 67362410 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3,5-bis(4-aminoanilino)pentane-1,4-diol |
| SMILES | Nc1ccc(NCC(O)C(CCO)Nc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H24N4O2/c18-12-1-5-14(6-2-12)20-11-17(23)16(9-10-22)21-15-7-3-13(19)4-8-15/h1-8,16-17,20-23H,9-11,18-19H2 |
| InChIKey | PEDJLYDILPYKRF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|