About 3,5-bis(4-aminoanilino)pentane-1,4-diol
3,5-bis(4-aminoanilino)pentane-1,4-diol (PubChem CID 67362410) has the molecular formula C17H24N4O2
and a molecular weight of 316.41 g/mol. Its IUPAC name is 3,5-bis(4-aminoanilino)pentane-1,4-diol.
Molecular Properties
| Compound Name | 3,5-bis(4-aminoanilino)pentane-1,4-diol |
| PubChem CID | 67362410 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3,5-bis(4-aminoanilino)pentane-1,4-diol |
| SMILES | Nc1ccc(NCC(O)C(CCO)Nc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H24N4O2/c18-12-1-5-14(6-2-12)20-11-17(23)16(9-10-22)21-15-7-3-13(19)4-8-15/h1-8,16-17,20-23H,9-11,18-19H2 |
| InChIKey | PEDJLYDILPYKRF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(4-aminoanilino)pentane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(4-aminoanilino)pentane-1,4-diol?
The IUPAC name of 3,5-bis(4-aminoanilino)pentane-1,4-diol (CID 67362410) is 3,5-bis(4-aminoanilino)pentane-1,4-diol.
What is the SMILES notation for 3,5-bis(4-aminoanilino)pentane-1,4-diol?
The canonical SMILES for 3,5-bis(4-aminoanilino)pentane-1,4-diol is Nc1ccc(NCC(O)C(CCO)Nc2ccc(N)cc2)cc1.
What is the InChIKey of 3,5-bis(4-aminoanilino)pentane-1,4-diol?
The InChIKey is PEDJLYDILPYKRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O2/c18-12-1-5-14(6-2-12)20-11-17(23)16(9-10-22)21-15-7-3-13(19)4-8-15/h1-8,16-17,20-23H,9-11,18-19H2.
What are the key properties of 3,5-bis(4-aminoanilino)pentane-1,4-diol?
3,5-bis(4-aminoanilino)pentane-1,4-diol has a molecular weight of 316.41 g/mol, XLogP of 1.49, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(4-aminoanilino)pentane-1,4-diol is sourced from PubChem (CID 67362410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).