C14H24N2 — CID 61469616
4-N-(6-methylheptan-2-yl)benzene-1,4-diamine (PubChem CID 61469616) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-N-(6-methylheptan-2-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(6-methylheptan-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 61469616 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-N-(6-methylheptan-2-yl)benzene-1,4-diamine |
| SMILES | CC(C)CCCC(C)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C14H24N2/c1-11(2)5-4-6-12(3)16-14-9-7-13(15)8-10-14/h7-12,16H,4-6,15H2,1-3H3 |
| InChIKey | XPIDCMIKCNTCPX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|