C12H18N2 — CID 70292909
4-N-hex-5-en-2-ylbenzene-1,4-diamine (PubChem CID 70292909) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-N-hex-5-en-2-ylbenzene-1,4-diamine.
| Compound Name | 4-N-hex-5-en-2-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 70292909 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-N-hex-5-en-2-ylbenzene-1,4-diamine |
| SMILES | C=CCCC(C)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C12H18N2/c1-3-4-5-10(2)14-12-8-6-11(13)7-9-12/h3,6-10,14H,1,4-5,13H2,2H3 |
| InChIKey | IUTDBMJGWANAIZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|