C14H25N3O2S — CID 61469316
3-amino-5-(6-methylheptan-2-ylamino)benzenesulfonamide (PubChem CID 61469316) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 3-amino-5-(6-methylheptan-2-ylamino)benzenesulfonamide.
| Compound Name | 3-amino-5-(6-methylheptan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 61469316 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-amino-5-(6-methylheptan-2-ylamino)benzenesulfonamide |
| SMILES | CC(C)CCCC(C)Nc1cc(N)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H25N3O2S/c1-10(2)5-4-6-11(3)17-13-7-12(15)8-14(9-13)20(16,18)19/h7-11,17H,4-6,15H2,1-3H3,(H2,16,18,19) |
| InChIKey | KPAXFYMTEDHUFQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|