C9H15N3O2S — CID 60987493
3-amino-5-(propan-2-ylamino)benzenesulfonamide (PubChem CID 60987493) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 3-amino-5-(propan-2-ylamino)benzenesulfonamide.
| Compound Name | 3-amino-5-(propan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 60987493 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-amino-5-(propan-2-ylamino)benzenesulfonamide |
| SMILES | CC(C)Nc1cc(N)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H15N3O2S/c1-6(2)12-8-3-7(10)4-9(5-8)15(11,13)14/h3-6,12H,10H2,1-2H3,(H2,11,13,14) |
| InChIKey | OGSGBBOETCASDD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|