C12H21N3O2S — CID 64568413
3-amino-5-(2,3-dimethylbutylamino)benzenesulfonamide (PubChem CID 64568413) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 3-amino-5-(2,3-dimethylbutylamino)benzenesulfonamide.
| Compound Name | 3-amino-5-(2,3-dimethylbutylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 64568413 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-amino-5-(2,3-dimethylbutylamino)benzenesulfonamide |
| SMILES | CC(C)C(C)CNc1cc(N)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H21N3O2S/c1-8(2)9(3)7-15-11-4-10(13)5-12(6-11)18(14,16)17/h4-6,8-9,15H,7,13H2,1-3H3,(H2,14,16,17) |
| InChIKey | RANATSXXHPPVAH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|