C12H15N3O3S2 — CID 106434544
3-amino-5-[(2-hydroxy-2-thiophen-3-ylethyl)amino]benzenesulfonamide (PubChem CID 106434544) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-amino-5-[(2-hydroxy-2-thiophen-3-ylethyl)amino]benzenesulfonamide.
| Compound Name | 3-amino-5-[(2-hydroxy-2-thiophen-3-ylethyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106434544 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-amino-5-[(2-hydroxy-2-thiophen-3-ylethyl)amino]benzenesulfonamide |
| SMILES | Nc1cc(NCC(O)c2ccsc2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H15N3O3S2/c13-9-3-10(5-11(4-9)20(14,17)18)15-6-12(16)8-1-2-19-7-8/h1-5,7,12,15-16H,6,13H2,(H2,14,17,18) |
| InChIKey | XIGJLNCHFBZBBY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|