C10H11N3O2S — CID 106436529
4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-1H-pyridazin-6-one (PubChem CID 106436529) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-1H-pyridazin-6-one.
| Compound Name | 4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 106436529 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-1H-pyridazin-6-one |
| SMILES | O=c1cc(NCC(O)c2ccsc2)cn[nH]1 |
| InChI | InChI=1S/C10H11N3O2S/c14-9(7-1-2-16-6-7)5-11-8-3-10(15)13-12-4-8/h1-4,6,9,14H,5H2,(H2,11,13,15) |
| InChIKey | ZJSBVLUMFVZGEF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |