C10H13N3OS — CID 111440446
2-(1H-pyrazol-5-ylmethylamino)-1-thiophen-3-ylethanol (PubChem CID 111440446) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-ylmethylamino)-1-thiophen-3-ylethanol.
| Compound Name | 2-(1H-pyrazol-5-ylmethylamino)-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 111440446 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(1H-pyrazol-5-ylmethylamino)-1-thiophen-3-ylethanol |
| SMILES | OC(CNCc1ccn[nH]1)c1ccsc1 |
| InChI | InChI=1S/C10H13N3OS/c14-10(8-2-4-15-7-8)6-11-5-9-1-3-12-13-9/h1-4,7,10-11,14H,5-6H2,(H,12,13) |
| InChIKey | OYPPCIFKBZBDMK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |