C15H21N3O2 — CID 111423579
1-(3-propan-2-yloxyphenyl)-2-(1H-pyrazol-5-ylmethylamino)ethanol (PubChem CID 111423579) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(3-propan-2-yloxyphenyl)-2-(1H-pyrazol-5-ylmethylamino)ethanol.
| Compound Name | 1-(3-propan-2-yloxyphenyl)-2-(1H-pyrazol-5-ylmethylamino)ethanol |
|---|---|
| PubChem CID | 111423579 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-(3-propan-2-yloxyphenyl)-2-(1H-pyrazol-5-ylmethylamino)ethanol |
| SMILES | CC(C)Oc1cccc(C(O)CNCc2ccn[nH]2)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-11(2)20-14-5-3-4-12(8-14)15(19)10-16-9-13-6-7-17-18-13/h3-8,11,15-16,19H,9-10H2,1-2H3,(H,17,18) |
| InChIKey | JLVUWTFBEJJPQR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |