C9H15N5O3S — CID 83115831
2-(3-amino-5-sulfamoylanilino)ethylurea (PubChem CID 83115831) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-(3-amino-5-sulfamoylanilino)ethylurea.
| Compound Name | 2-(3-amino-5-sulfamoylanilino)ethylurea |
|---|---|
| PubChem CID | 83115831 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(3-amino-5-sulfamoylanilino)ethylurea |
| SMILES | NC(=O)NCCNc1cc(N)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H15N5O3S/c10-6-3-7(13-1-2-14-9(11)15)5-8(4-6)18(12,16)17/h3-5,13H,1-2,10H2,(H3,11,14,15)(H2,12,16,17) |
| InChIKey | DPKRJFLJLUZMRQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|