C12H14BrN3O2S2 — CID 106037433
3-amino-5-[2-(5-bromothiophen-2-yl)ethylamino]benzenesulfonamide (PubChem CID 106037433) has the molecular formula C12H14BrN3O2S2 and a molecular weight of 376.30 g/mol. Its IUPAC name is 3-amino-5-[2-(5-bromothiophen-2-yl)ethylamino]benzenesulfonamide.
| Compound Name | 3-amino-5-[2-(5-bromothiophen-2-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 106037433 |
| Molecular Formula | C12H14BrN3O2S2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 3-amino-5-[2-(5-bromothiophen-2-yl)ethylamino]benzenesulfonamide |
| SMILES | Nc1cc(NCCc2ccc(Br)s2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H14BrN3O2S2/c13-12-2-1-10(19-12)3-4-16-9-5-8(14)6-11(7-9)20(15,17)18/h1-2,5-7,16H,3-4,14H2,(H2,15,17,18) |
| InChIKey | DCYGYTPBIBXVQR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|