C12H11BrF2N2O2S2 — CID 106035077
5-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-2,3-difluorobenzenesulfonamide (PubChem CID 106035077) has the molecular formula C12H11BrF2N2O2S2 and a molecular weight of 397.27 g/mol. Its IUPAC name is 5-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-2,3-difluorobenzenesulfonamide.
| Compound Name | 5-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-2,3-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106035077 |
| Molecular Formula | C12H11BrF2N2O2S2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | 5-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-2,3-difluorobenzenesulfonamide |
| SMILES | Nc1cc(F)c(F)c(S(=O)(=O)NCCc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C12H11BrF2N2O2S2/c13-11-2-1-8(20-11)3-4-17-21(18,19)10-6-7(16)5-9(14)12(10)15/h1-2,5-6,17H,3-4,16H2 |
| InChIKey | MKYBYLRLWXWQBG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|