C13H13Br2NO2S2 — CID 103606955
5-bromo-N-[2-(5-bromothiophen-2-yl)ethyl]-2-methylbenzenesulfonamide (PubChem CID 103606955) has the molecular formula C13H13Br2NO2S2 and a molecular weight of 439.19 g/mol. Its IUPAC name is 5-bromo-N-[2-(5-bromothiophen-2-yl)ethyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-bromo-N-[2-(5-bromothiophen-2-yl)ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103606955 |
| Molecular Formula | C13H13Br2NO2S2 |
| Molecular Weight | 439.19 g/mol |
| Exact Mass | 436.88 |
| IUPAC Name | 5-bromo-N-[2-(5-bromothiophen-2-yl)ethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H13Br2NO2S2/c1-9-2-3-10(14)8-12(9)20(17,18)16-7-6-11-4-5-13(15)19-11/h2-5,8,16H,6-7H2,1H3 |
| InChIKey | FGWYGUKUIOFMKU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |