C10H10F2N2O2S — CID 65022706
5-amino-N-but-3-ynyl-2,3-difluorobenzenesulfonamide (PubChem CID 65022706) has the molecular formula C10H10F2N2O2S and a molecular weight of 260.26 g/mol. Its IUPAC name is 5-amino-N-but-3-ynyl-2,3-difluorobenzenesulfonamide.
| Compound Name | 5-amino-N-but-3-ynyl-2,3-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 65022706 |
| Molecular Formula | C10H10F2N2O2S |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 5-amino-N-but-3-ynyl-2,3-difluorobenzenesulfonamide |
| SMILES | C#CCCNS(=O)(=O)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C10H10F2N2O2S/c1-2-3-4-14-17(15,16)9-6-7(13)5-8(11)10(9)12/h1,5-6,14H,3-4,13H2 |
| InChIKey | GQBSDNSLJRGIPP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|