C13H18F2N2O3S — CID 65022454
5-amino-N-(2-cyclopentyloxyethyl)-2,3-difluorobenzenesulfonamide (PubChem CID 65022454) has the molecular formula C13H18F2N2O3S and a molecular weight of 320.36 g/mol. Its IUPAC name is 5-amino-N-(2-cyclopentyloxyethyl)-2,3-difluorobenzenesulfonamide.
| Compound Name | 5-amino-N-(2-cyclopentyloxyethyl)-2,3-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 65022454 |
| Molecular Formula | C13H18F2N2O3S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-amino-N-(2-cyclopentyloxyethyl)-2,3-difluorobenzenesulfonamide |
| SMILES | Nc1cc(F)c(F)c(S(=O)(=O)NCCOC2CCCC2)c1 |
| InChI | InChI=1S/C13H18F2N2O3S/c14-11-7-9(16)8-12(13(11)15)21(18,19)17-5-6-20-10-3-1-2-4-10/h7-8,10,17H,1-6,16H2 |
| InChIKey | UKPYNQRXEHPRAN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|