C14H21FN2O3S — CID 63823533
5-amino-N-(2-cyclohexyloxyethyl)-2-fluorobenzenesulfonamide (PubChem CID 63823533) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is 5-amino-N-(2-cyclohexyloxyethyl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-amino-N-(2-cyclohexyloxyethyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 63823533 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 5-amino-N-(2-cyclohexyloxyethyl)-2-fluorobenzenesulfonamide |
| SMILES | Nc1ccc(F)c(S(=O)(=O)NCCOC2CCCCC2)c1 |
| InChI | InChI=1S/C14H21FN2O3S/c15-13-7-6-11(16)10-14(13)21(18,19)17-8-9-20-12-4-2-1-3-5-12/h6-7,10,12,17H,1-5,8-9,16H2 |
| InChIKey | PLWKEIPJGHGUCZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|