C15H18BrN3O3S2 — CID 30696855
1-[2-(5-bromothiophen-2-yl)ethyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 30696855) has the molecular formula C15H18BrN3O3S2 and a molecular weight of 432.37 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 30696855 |
| Molecular Formula | C15H18BrN3O3S2 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)NCCc2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C15H18BrN3O3S2/c16-14-6-3-12(23-14)8-10-19-15(20)18-9-7-11-1-4-13(5-2-11)24(17,21)22/h1-6H,7-10H2,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | FEACEEJTIFXHSA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |