C13H21N3O5S — CID 108894482
1-(2-methoxyethoxymethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 108894482) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-(2-methoxyethoxymethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-(2-methoxyethoxymethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108894482 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-(2-methoxyethoxymethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | COCCOCNC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21N3O5S/c1-20-8-9-21-10-16-13(17)15-7-6-11-2-4-12(5-3-11)22(14,18)19/h2-5H,6-10H2,1H3,(H2,14,18,19)(H2,15,16,17) |
| InChIKey | KJIANEGZQFOUQG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|