C16H23N3O5S — CID 108972706
1-N'-(2-methoxyethyl)-1-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108972706) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-N'-(2-methoxyethyl)-1-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2-methoxyethyl)-1-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108972706 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-N'-(2-methoxyethyl)-1-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COCCNC(=O)C1(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C16H23N3O5S/c1-24-11-10-19-15(21)16(7-8-16)14(20)18-9-6-12-2-4-13(5-3-12)25(17,22)23/h2-5H,6-11H2,1H3,(H,18,20)(H,19,21)(H2,17,22,23) |
| InChIKey | HUXCLDROXMTEJN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|